C15H13N3O2 — CID 110748624
1-(1,3-benzoxazol-5-yl)-3-benzylurea (PubChem CID 110748624) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-5-yl)-3-benzylurea.
| Compound Name | 1-(1,3-benzoxazol-5-yl)-3-benzylurea |
|---|---|
| PubChem CID | 110748624 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-(1,3-benzoxazol-5-yl)-3-benzylurea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H13N3O2/c19-15(16-9-11-4-2-1-3-5-11)18-12-6-7-14-13(8-12)17-10-20-14/h1-8,10H,9H2,(H2,16,18,19) |
| InChIKey | CDXHKYBGMDXZPE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |