C15H13IN4O — CID 59023753
1-benzyl-3-(3-iodo-2H-indazol-5-yl)urea (PubChem CID 59023753) has the molecular formula C15H13IN4O and a molecular weight of 392.20 g/mol. Its IUPAC name is 1-benzyl-3-(3-iodo-2H-indazol-5-yl)urea.
| Compound Name | 1-benzyl-3-(3-iodo-2H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 59023753 |
| Molecular Formula | C15H13IN4O |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 1-benzyl-3-(3-iodo-2H-indazol-5-yl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc2n[nH]c(I)c2c1 |
| InChI | InChI=1S/C15H13IN4O/c16-14-12-8-11(6-7-13(12)19-20-14)18-15(21)17-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | VYFHYSBFIRQOEE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|