C15H14FN5O — CID 25009850
1-(3-amino-1H-indazol-5-yl)-3-[(3-fluorophenyl)methyl]urea (PubChem CID 25009850) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(3-amino-1H-indazol-5-yl)-3-[(3-fluorophenyl)methyl]urea.
| Compound Name | 1-(3-amino-1H-indazol-5-yl)-3-[(3-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 25009850 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(3-amino-1H-indazol-5-yl)-3-[(3-fluorophenyl)methyl]urea |
| SMILES | Nc1n[nH]c2ccc(NC(=O)NCc3cccc(F)c3)cc12 |
| InChI | InChI=1S/C15H14FN5O/c16-10-3-1-2-9(6-10)8-18-15(22)19-11-4-5-13-12(7-11)14(17)21-20-13/h1-7H,8H2,(H3,17,20,21)(H2,18,19,22) |
| InChIKey | YXINOFHPZGFUMB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |