C21H19FN4O2 — CID 135222520
N-[(3-fluorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide (PubChem CID 135222520) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 135222520 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(C(=O)NCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H19FN4O2/c22-18-3-1-2-16(12-18)14-24-20(27)17-4-6-19(7-5-17)26-21(28)25-13-15-8-10-23-11-9-15/h1-12H,13-14H2,(H,24,27)(H2,25,26,28) |
| InChIKey | FVMQBAZTZISKHE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |