C21H18Cl2N4O2 — CID 171778259
N-[(2,6-dichlorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide (PubChem CID 171778259) has the molecular formula C21H18Cl2N4O2 and a molecular weight of 429.31 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 171778259 |
| Molecular Formula | C21H18Cl2N4O2 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(C(=O)NCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N4O2/c22-18-2-1-3-19(23)17(18)13-25-20(28)15-4-6-16(7-5-15)27-21(29)26-12-14-8-10-24-11-9-14/h1-11H,12-13H2,(H,25,28)(H2,26,27,29) |
| InChIKey | FSQPKAJUNATYBT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |