C22H22N4O4S — CID 164515186
N-ethyl-4-[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide (PubChem CID 164515186) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-ethyl-4-[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide.
| Compound Name | N-ethyl-4-[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 164515186 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-ethyl-4-[4-(pyridin-4-ylmethylcarbamoylamino)phenyl]sulfonylbenzamide |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)c2ccc(NC(=O)NCc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c1-2-24-21(27)17-3-7-19(8-4-17)31(29,30)20-9-5-18(6-10-20)26-22(28)25-15-16-11-13-23-14-12-16/h3-14H,2,15H2,1H3,(H,24,27)(H2,25,26,28) |
| InChIKey | YTJLQFWUZJEVFR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |