C22H21FN4O2 — CID 135231083
N-[2-(4-fluorophenyl)ethyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide (PubChem CID 135231083) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 135231083 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-(pyridin-4-ylmethylcarbamoylamino)benzamide |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(C(=O)NCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c23-19-5-1-16(2-6-19)11-14-25-21(28)18-3-7-20(8-4-18)27-22(29)26-15-17-9-12-24-13-10-17/h1-10,12-13H,11,14-15H2,(H,25,28)(H2,26,27,29) |
| InChIKey | RUJQDKOBTNXKRA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |