C20H19FN4O3S — CID 135231176
1-[4-[(4-fluorophenyl)methylsulfonylamino]phenyl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 135231176) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methylsulfonylamino]phenyl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-[(4-fluorophenyl)methylsulfonylamino]phenyl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 135231176 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methylsulfonylamino]phenyl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(NS(=O)(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H19FN4O3S/c21-17-3-1-16(2-4-17)14-29(27,28)25-19-7-5-18(6-8-19)24-20(26)23-13-15-9-11-22-12-10-15/h1-12,25H,13-14H2,(H2,23,24,26) |
| InChIKey | JMRWRUNAEMQFGW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |