C21H19F3N4O3S — CID 171778522
1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]phenyl]urea (PubChem CID 171778522) has the molecular formula C21H19F3N4O3S and a molecular weight of 464.47 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]phenyl]urea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 171778522 |
| Molecular Formula | C21H19F3N4O3S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethyl)phenyl]methylsulfonylamino]phenyl]urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(NS(=O)(=O)Cc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N4O3S/c22-21(23,24)19-4-2-1-3-16(19)14-32(30,31)28-18-7-5-17(6-8-18)27-20(29)26-13-15-9-11-25-12-10-15/h1-12,28H,13-14H2,(H2,26,27,29) |
| InChIKey | MMLOAASGGYNTKO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |