C20H17F3N4O3S — CID 66611194
1-(pyridin-3-ylmethyl)-3-[4-[[4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]urea (PubChem CID 66611194) has the molecular formula C20H17F3N4O3S and a molecular weight of 450.44 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-3-[4-[[4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]urea.
| Compound Name | 1-(pyridin-3-ylmethyl)-3-[4-[[4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 66611194 |
| Molecular Formula | C20H17F3N4O3S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-3-[4-[[4-(trifluoromethyl)phenyl]sulfamoyl]phenyl]urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3N4O3S/c21-20(22,23)15-3-5-17(6-4-15)27-31(29,30)18-9-7-16(8-10-18)26-19(28)25-13-14-2-1-11-24-12-14/h1-12,27H,13H2,(H2,25,26,28) |
| InChIKey | SESNTRUECVJNQO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |