C18H16FN5O3S — CID 66611256
1-[4-[(5-fluoro-3-pyridinyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66611256) has the molecular formula C18H16FN5O3S and a molecular weight of 401.42 g/mol. Its IUPAC name is 1-[4-[(5-fluoro-3-pyridinyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(5-fluoro-3-pyridinyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66611256 |
| Molecular Formula | C18H16FN5O3S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[4-[(5-fluoro-3-pyridinyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)Nc2cncc(F)c2)cc1 |
| InChI | InChI=1S/C18H16FN5O3S/c19-14-8-16(12-21-11-14)24-28(26,27)17-5-3-15(4-6-17)23-18(25)22-10-13-2-1-7-20-9-13/h1-9,11-12,24H,10H2,(H2,22,23,25) |
| InChIKey | QWDABGUCIXJIND-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |