C20H19ClN4O3S — CID 66610132
1-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66610132) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 1-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66610132 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-14-18(21)5-2-6-19(14)25-29(27,28)17-9-7-16(8-10-17)24-20(26)23-13-15-4-3-11-22-12-15/h2-12,25H,13H2,1H3,(H2,23,24,26) |
| InChIKey | IFTNSPXRACMRBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |