C20H16ClF3N4O4S — CID 66610775
1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 66610775) has the molecular formula C20H16ClF3N4O4S and a molecular weight of 500.89 g/mol. Its IUPAC name is 1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 66610775 |
| Molecular Formula | C20H16ClF3N4O4S |
| Molecular Weight | 500.89 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)Nc2ccc(OC(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H16ClF3N4O4S/c21-17-10-15(5-8-18(17)32-20(22,23)24)28-33(30,31)16-6-3-14(4-7-16)27-19(29)26-12-13-2-1-9-25-11-13/h1-11,28H,12H2,(H2,26,27,29) |
| InChIKey | RZWAHDSIHWWETA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |