C21H19F3N4O4S — CID 135223136
1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]urea (PubChem CID 135223136) has the molecular formula C21H19F3N4O4S and a molecular weight of 480.47 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]urea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 135223136 |
| Molecular Formula | C21H19F3N4O4S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[4-[[2-(trifluoromethoxy)phenyl]methylsulfamoyl]phenyl]urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(S(=O)(=O)NCc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N4O4S/c22-21(23,24)32-19-4-2-1-3-16(19)14-27-33(30,31)18-7-5-17(6-8-18)28-20(29)26-13-15-9-11-25-12-10-15/h1-12,27H,13-14H2,(H2,26,28,29) |
| InChIKey | IZNMYBITLLBDJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |