C27H19F2N5O — CID 163372167
1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 163372167) has the molecular formula C27H19F2N5O and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 163372167 |
| Molecular Formula | C27H19F2N5O |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)Nc1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C27H19F2N5O/c28-20-5-1-18(2-6-20)25-26(19-3-7-21(29)8-4-19)34-24-15-22(9-10-23(24)33-25)32-27(35)31-16-17-11-13-30-14-12-17/h1-15H,16H2,(H2,31,32,35) |
| InChIKey | GYSZICQPJWAVNY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |