C27H20F2N6S — CID 169286552
1-[(6-amino-3-pyridinyl)methyl]-3-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]thiourea (PubChem CID 169286552) has the molecular formula C27H20F2N6S and a molecular weight of 498.56 g/mol. Its IUPAC name is 1-[(6-amino-3-pyridinyl)methyl]-3-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]thiourea.
| Compound Name | 1-[(6-amino-3-pyridinyl)methyl]-3-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]thiourea |
|---|---|
| PubChem CID | 169286552 |
| Molecular Formula | C27H20F2N6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-[(6-amino-3-pyridinyl)methyl]-3-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]thiourea |
| SMILES | Nc1ccc(CNC(=S)Nc2ccc3nc(-c4ccc(F)cc4)c(-c4ccc(F)cc4)nc3c2)cn1 |
| InChI | InChI=1S/C27H20F2N6S/c28-19-6-2-17(3-7-19)25-26(18-4-8-20(29)9-5-18)35-23-13-21(10-11-22(23)34-25)33-27(36)32-15-16-1-12-24(30)31-14-16/h1-14H,15H2,(H2,30,31)(H2,32,33,36) |
| InChIKey | HSDNINKSGGOKCW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|