C27H26F2N6O — CID 156743585
1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 156743585) has the molecular formula C27H26F2N6O and a molecular weight of 488.54 g/mol. Its IUPAC name is 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 156743585 |
| Molecular Formula | C27H26F2N6O |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 1-[2,3-bis(4-fluorophenyl)quinoxalin-6-yl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCNCC1)Nc1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C27H26F2N6O/c28-20-5-1-18(2-6-20)25-26(19-3-7-21(29)8-4-19)34-24-17-22(9-10-23(24)33-25)32-27(36)31-13-16-35-14-11-30-12-15-35/h1-10,17,30H,11-16H2,(H2,31,32,36) |
| InChIKey | HSEFGFKWTRNVBI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |