C15H20FN3O — CID 43600198
(E)-3-(4-fluorophenyl)-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 43600198) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43600198 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H20FN3O/c16-14-4-1-13(2-5-14)3-6-15(20)18-9-12-19-10-7-17-8-11-19/h1-6,17H,7-12H2,(H,18,20)/b6-3+ |
| InChIKey | VYTYNUFBLXBENN-ZZXKWVIFSA-N |
| XLogP | 0.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|