C22H25F2N3O2 — CID 97455101
(Z)-3-(3-fluoro-4-methoxyphenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide (PubChem CID 97455101) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is (Z)-3-(3-fluoro-4-methoxyphenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-fluoro-4-methoxyphenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 97455101 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (Z)-3-(3-fluoro-4-methoxyphenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)NCCN2CCN(c3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H25F2N3O2/c1-29-21-8-2-17(16-20(21)24)3-9-22(28)25-10-11-26-12-14-27(15-13-26)19-6-4-18(23)5-7-19/h2-9,16H,10-15H2,1H3,(H,25,28)/b9-3- |
| InChIKey | BQEFXPIHUYWVIO-OQFOIZHKSA-N |
| XLogP | 2.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|