C22H26ClN3O — CID 38756154
(E)-3-(3-chloro-4-methylphenyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide (PubChem CID 38756154) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 38756154 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-N-[2-(4-phenylpiperazin-1-yl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCCN2CCN(c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O/c1-18-7-8-19(17-21(18)23)9-10-22(27)24-11-12-25-13-15-26(16-14-25)20-5-3-2-4-6-20/h2-10,17H,11-16H2,1H3,(H,24,27)/b10-9+ |
| InChIKey | LNXMFRHTASYUFG-MDZDMXLPSA-N |
| XLogP | 3.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|