C21H23ClFN3O — CID 34999381
(E)-3-(2-chlorophenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide (PubChem CID 34999381) has the molecular formula C21H23ClFN3O and a molecular weight of 387.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 34999381 |
| Molecular Formula | C21H23ClFN3O |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23ClFN3O/c22-20-4-2-1-3-17(20)5-10-21(27)24-11-12-25-13-15-26(16-14-25)19-8-6-18(23)7-9-19/h1-10H,11-16H2,(H,24,27)/b10-5+ |
| InChIKey | JJUXNUIDOOGHSD-BJMVGYQFSA-N |
| XLogP | 3.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|