C25H31F2N3O3 — CID 30900318
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]prop-2-enamide (PubChem CID 30900318) has the molecular formula C25H31F2N3O3 and a molecular weight of 459.54 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 30900318 |
| Molecular Formula | C25H31F2N3O3 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCCN2CCN(c3cccc(C)c3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C25H31F2N3O3/c1-3-32-23-18-20(7-9-22(23)33-25(26)27)8-10-24(31)28-11-12-29-13-15-30(16-14-29)21-6-4-5-19(2)17-21/h4-10,17-18,25H,3,11-16H2,1-2H3,(H,28,31)/b10-8+ |
| InChIKey | CNZFXKAJIOZIJQ-CSKARUKUSA-N |
| XLogP | 3.95 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|