C24H30N4O3 — CID 30885469
2-(4-cyano-2-ethoxyphenoxy)-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]acetamide (PubChem CID 30885469) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]acetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 30885469 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)NCCN1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-3-30-23-16-20(17-25)7-8-22(23)31-18-24(29)26-9-10-27-11-13-28(14-12-27)21-6-4-5-19(2)15-21/h4-8,15-16H,3,9-14,18H2,1-2H3,(H,26,29) |
| InChIKey | SBTBKZOOVNROKJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |