C16H24Cl2FN3O — CID 118480970
(E)-3-(2-fluorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide;dihydrochloride (PubChem CID 118480970) has the molecular formula C16H24Cl2FN3O and a molecular weight of 364.29 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide;dihydrochloride.
| Compound Name | (E)-3-(2-fluorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 118480970 |
| Molecular Formula | C16H24Cl2FN3O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-(3-piperazin-1-ylpropyl)prop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(/C=C/c1ccccc1F)NCCCN1CCNCC1 |
| InChI | InChI=1S/C16H22FN3O.2ClH/c17-15-5-2-1-4-14(15)6-7-16(21)19-8-3-11-20-12-9-18-10-13-20;;/h1-2,4-7,18H,3,8-13H2,(H,19,21);2*1H/b7-6+;; |
| InChIKey | SWKYTCMESSMRJQ-KMXZHCNGSA-N |
| XLogP | 2.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|