C16H20F2N2O2 — CID 90264836
(E)-3-(2,4-difluorophenyl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide (PubChem CID 90264836) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is (E)-3-(2,4-difluorophenyl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-difluorophenyl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 90264836 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)-N-(3-morpholin-4-ylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1F)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-14-4-2-13(15(18)12-14)3-5-16(21)19-6-1-7-20-8-10-22-11-9-20/h2-5,12H,1,6-11H2,(H,19,21)/b5-3+ |
| InChIKey | UIGGCTFLEZQVMF-HWKANZROSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|