C16H23F2N3O2 — CID 99638302
1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 99638302) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 99638302 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[(1S)-1-(2,4-difluorophenyl)ethyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | C[C@H](NC(=O)NCCCN1CCOCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N3O2/c1-12(14-4-3-13(17)11-15(14)18)20-16(22)19-5-2-6-21-7-9-23-10-8-21/h3-4,11-12H,2,5-10H2,1H3,(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | BZFDSUFUZOBKBE-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|