C17H21Cl2N3O2S — CID 4608649
3-(2,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylcarbamothioyl)prop-2-enamide (PubChem CID 4608649) has the molecular formula C17H21Cl2N3O2S and a molecular weight of 402.35 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylcarbamothioyl)prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 4608649 |
| Molecular Formula | C17H21Cl2N3O2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NC(=S)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2N3O2S/c18-14-4-2-13(15(19)12-14)3-5-16(23)21-17(25)20-6-1-7-22-8-10-24-11-9-22/h2-5,12H,1,6-11H2,(H2,20,21,23,25) |
| InChIKey | JZYFHKANDZZHSZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|