C25H37Cl2N3O — CID 92662572
(E)-3-(2,4-dichlorophenyl)-N-[3-[4-[methyl-[(1R,2S)-2-methylcyclohexyl]amino]piperidin-1-yl]propyl]prop-2-enamide (PubChem CID 92662572) has the molecular formula C25H37Cl2N3O and a molecular weight of 466.50 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[3-[4-[methyl-[(1R,2S)-2-methylcyclohexyl]amino]piperidin-1-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[3-[4-[methyl-[(1R,2S)-2-methylcyclohexyl]amino]piperidin-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 92662572 |
| Molecular Formula | C25H37Cl2N3O |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[3-[4-[methyl-[(1R,2S)-2-methylcyclohexyl]amino]piperidin-1-yl]propyl]prop-2-enamide |
| SMILES | C[C@H]1CCCC[C@H]1N(C)C1CCN(CCCNC(=O)/C=C/c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C25H37Cl2N3O/c1-19-6-3-4-7-24(19)29(2)22-12-16-30(17-13-22)15-5-14-28-25(31)11-9-20-8-10-21(26)18-23(20)27/h8-11,18-19,22,24H,3-7,12-17H2,1-2H3,(H,28,31)/b11-9+/t19-,24+/m0/s1 |
| InChIKey | BAABIFGTXNHFLE-OATMUCBLSA-N |
| XLogP | 5.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|