C26H41N3O3 — CID 45106232
(E)-3-(2,5-dimethoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]ethyl]prop-2-enamide (PubChem CID 45106232) has the molecular formula C26H41N3O3 and a molecular weight of 443.63 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 45106232 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]ethyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NCCN2CCC(N(C)C3CCCCC3C)CC2)c1 |
| InChI | InChI=1S/C26H41N3O3/c1-20-7-5-6-8-24(20)28(2)22-13-16-29(17-14-22)18-15-27-26(30)12-9-21-19-23(31-3)10-11-25(21)32-4/h9-12,19-20,22,24H,5-8,13-18H2,1-4H3,(H,27,30)/b12-9+ |
| InChIKey | JBHCMNNNKJNDTL-FMIVXFBMSA-N |
| XLogP | 3.81 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|