C23H37N3OS — CID 126457232
(E)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 126457232) has the molecular formula C23H37N3OS and a molecular weight of 403.64 g/mol. Its IUPAC name is (E)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 126457232 |
| Molecular Formula | C23H37N3OS |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (E)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC1CCCCC1N(C)C1CCN(CCCNC(=O)/C=C/c2cccs2)CC1 |
| InChI | InChI=1S/C23H37N3OS/c1-19-7-3-4-9-22(19)25(2)20-12-16-26(17-13-20)15-6-14-24-23(27)11-10-21-8-5-18-28-21/h5,8,10-11,18-20,22H,3-4,6-7,9,12-17H2,1-2H3,(H,24,27)/b11-10+ |
| InChIKey | JULDRBVVYBVBBQ-ZHACJKMWSA-N |
| XLogP | 4.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|