C24H37N3O — CID 92662561
(E)-N-[2-[4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 92662561) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is (E)-N-[2-[4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 92662561 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | (E)-N-[2-[4-[methyl-[(1R,2R)-2-methylcyclohexyl]amino]piperidin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H]1CCCC[C@H]1N(C)C1CCN(CCNC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H37N3O/c1-20-8-6-7-11-23(20)26(2)22-14-17-27(18-15-22)19-16-25-24(28)13-12-21-9-4-3-5-10-21/h3-5,9-10,12-13,20,22-23H,6-8,11,14-19H2,1-2H3,(H,25,28)/b13-12+/t20-,23-/m1/s1 |
| InChIKey | LWKXJUIYMMWRPW-FJYVLNHRSA-N |
| XLogP | 3.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|