C24H28N4O3S — CID 44897329
(E)-N-[2-[4-(4,7-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 44897329) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is (E)-N-[2-[4-(4,7-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(4,7-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44897329 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (E)-N-[2-[4-(4,7-dimethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(OC)c2sc(N3CCN(CCNC(=O)/C=C/c4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C24H28N4O3S/c1-30-19-9-10-20(31-2)23-22(19)26-24(32-23)28-16-14-27(15-17-28)13-12-25-21(29)11-8-18-6-4-3-5-7-18/h3-11H,12-17H2,1-2H3,(H,25,29)/b11-8+ |
| InChIKey | YGGNGFAAYOWTHZ-DHZHZOJOSA-N |
| XLogP | 3.27 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|