C24H28N4O2S — CID 44896801
(E)-N-[2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 44896801) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is (E)-N-[2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44896801 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (E)-N-[2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CCOc1cccc2sc(N3CCN(CCNC(=O)/C=C/c4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C24H28N4O2S/c1-2-30-20-9-6-10-21-23(20)26-24(31-21)28-17-15-27(16-18-28)14-13-25-22(29)12-11-19-7-4-3-5-8-19/h3-12H,2,13-18H2,1H3,(H,25,29)/b12-11+ |
| InChIKey | IPWPNNSDUPJATF-VAWYXSNFSA-N |
| XLogP | 3.65 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|