C24H34ClN3O2 — CID 24789433
(E)-3-(3-chlorophenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 24789433) has the molecular formula C24H34ClN3O2 and a molecular weight of 432.01 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 24789433 |
| Molecular Formula | C24H34ClN3O2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | CC1CCCCC1N(C)C1CCN(C(=O)CNC(=O)/C=C/c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H34ClN3O2/c1-18-6-3-4-9-22(18)27(2)21-12-14-28(15-13-21)24(30)17-26-23(29)11-10-19-7-5-8-20(25)16-19/h5,7-8,10-11,16,18,21-22H,3-4,6,9,12-15,17H2,1-2H3,(H,26,29)/b11-10+ |
| InChIKey | HFXXTNQBBOELEE-ZHACJKMWSA-N |
| XLogP | 3.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|