C25H37N3O3 — CID 46255256
(E)-3-(2-methoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 46255256) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 46255256 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-[2-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)NCC(=O)N1CCC(N(C)C2CCCCC2C)CC1 |
| InChI | InChI=1S/C25H37N3O3/c1-19-8-4-6-10-22(19)27(2)21-14-16-28(17-15-21)25(30)18-26-24(29)13-12-20-9-5-7-11-23(20)31-3/h5,7,9,11-13,19,21-22H,4,6,8,10,14-18H2,1-3H3,(H,26,29)/b13-12+ |
| InChIKey | DDPODYPLPTXOCJ-OUKQBFOZSA-N |
| XLogP | 3.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|