C16H21NO3 — CID 104957085
(E)-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 104957085) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 104957085 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-N-[(1S,2S)-2-hydroxycyclohexyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H21NO3/c1-20-15-9-5-2-6-12(15)10-11-16(19)17-13-7-3-4-8-14(13)18/h2,5-6,9-11,13-14,18H,3-4,7-8H2,1H3,(H,17,19)/b11-10+/t13-,14-/m0/s1 |
| InChIKey | FNKLNNVMGAYBQF-NKVPIJFCSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|