C16H20BrNO3 — CID 104957071
(E)-3-(5-bromo-2-methoxyphenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide (PubChem CID 104957071) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 104957071 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H20BrNO3/c1-21-15-8-7-12(17)10-11(15)6-9-16(20)18-13-4-2-3-5-14(13)19/h6-10,13-14,19H,2-5H2,1H3,(H,18,20)/b9-6+/t13-,14-/m0/s1 |
| InChIKey | PWVDZPHLNUZSKJ-HXUSNMGPSA-N |
| XLogP | 2.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|