C17H23NO5 — CID 14967664
(E)-N-(2-hydroxycyclopentyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 14967664) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is (E)-N-(2-hydroxycyclopentyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-hydroxycyclopentyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 14967664 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (E)-N-(2-hydroxycyclopentyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCCC2O)cc(OC)c1OC |
| InChI | InChI=1S/C17H23NO5/c1-21-14-9-11(10-15(22-2)17(14)23-3)7-8-16(20)18-12-5-4-6-13(12)19/h7-10,12-13,19H,4-6H2,1-3H3,(H,18,20)/b8-7+ |
| InChIKey | ADGDYOXUNGXSGC-BQYQJAHWSA-N |
| XLogP | 1.76 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|