C20H28ClN3O3S — CID 11945870
1-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11945870) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is 1-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11945870 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | COc1cc(/C=C/C(=O)NNC(=S)N[C@@H]2CCC[C@@H](C)[C@H]2C)cc(Cl)c1OC |
| InChI | InChI=1S/C20H28ClN3O3S/c1-12-6-5-7-16(13(12)2)22-20(28)24-23-18(25)9-8-14-10-15(21)19(27-4)17(11-14)26-3/h8-13,16H,5-7H2,1-4H3,(H,23,25)(H2,22,24,28)/b9-8+/t12-,13-,16-/m1/s1 |
| InChIKey | DGSQJZFIYJAXFR-MVAKEXEHSA-N |
| XLogP | 3.69 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|