C22H31NO6 — CID 11916045
[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 11916045) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11916045 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc(OC)c1OC |
| InChI | InChI=1S/C22H31NO6/c1-14-7-6-8-17(15(14)2)23-20(24)13-29-21(25)10-9-16-11-18(26-3)22(28-5)19(12-16)27-4/h9-12,14-15,17H,6-8,13H2,1-5H3,(H,23,24)/b10-9+/t14-,15+,17+/m0/s1 |
| InChIKey | XBGGRIQRUKEQDU-IVBBAJINSA-N |
| XLogP | 3.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|