C18H23NO8S — CID 4598622
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 4598622) has the molecular formula C18H23NO8S and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4598622 |
| Molecular Formula | C18H23NO8S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23NO8S/c1-24-14-8-12(9-15(25-2)18(14)26-3)4-5-17(21)27-10-16(20)19-13-6-7-28(22,23)11-13/h4-5,8-9,13H,6-7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | XNNQPQLVSLGYQG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|