C11H17NO5S — CID 8759697
[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 8759697) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8759697 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17NO5S/c1-8(2)5-11(14)17-6-10(13)12-9-3-4-18(15,16)7-9/h5,9H,3-4,6-7H2,1-2H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | OULAEFRRMTZRMP-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|