C20H29N3O2S — CID 11945993
1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]thiourea (PubChem CID 11945993) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 11945993 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]thiourea |
| SMILES | CCOc1ccc(/C=C/C(=O)NNC(=S)N[C@@H]2CCC[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-4-25-17-11-8-16(9-12-17)10-13-19(24)22-23-20(26)21-18-7-5-6-14(2)15(18)3/h8-15,18H,4-7H2,1-3H3,(H,22,24)(H2,21,23,26)/b13-10+/t14-,15+,18-/m1/s1 |
| InChIKey | XRTDPQZSMIJZIH-GFCBYFFGSA-N |
| XLogP | 3.42 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|