C20H29N3O2S — CID 11946358
1-[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11946358) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11946358 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[[2-(2,3-dihydro-1H-inden-5-yloxy)acetyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H29N3O2S/c1-13-5-3-8-18(14(13)2)21-20(26)23-22-19(24)12-25-17-10-9-15-6-4-7-16(15)11-17/h9-11,13-14,18H,3-8,12H2,1-2H3,(H,22,24)(H2,21,23,26)/t13-,14-,18-/m1/s1 |
| InChIKey | ORETWBIUZSWZLR-HBUWYVDXSA-N |
| XLogP | 2.87 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|