C17H24ClNO3 — CID 7887810
3-chloro-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-4,5-dimethoxybenzamide (PubChem CID 7887810) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-chloro-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 7887810 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-chloro-N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@H]2CCC[C@H](C)[C@@H]2C)cc(Cl)c1OC |
| InChI | InChI=1S/C17H24ClNO3/c1-10-6-5-7-14(11(10)2)19-17(20)12-8-13(18)16(22-4)15(9-12)21-3/h8-11,14H,5-7H2,1-4H3,(H,19,20)/t10-,11-,14-/m0/s1 |
| InChIKey | ABHPPNDWQNKAKC-MJVIPROJSA-N |
| XLogP | 3.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |