C16H23NO2 — CID 51665263
N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-methoxybenzamide (PubChem CID 51665263) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-methoxybenzamide.
| Compound Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 51665263 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-11-5-4-6-15(12(11)2)17-16(18)13-7-9-14(19-3)10-8-13/h7-12,15H,4-6H2,1-3H3,(H,17,18)/t11-,12+,15+/m0/s1 |
| InChIKey | CYQWYISVKCJETE-YWPYICTPSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |