C15H17BrFNO2 — CID 104956948
(E)-3-(5-bromo-2-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide (PubChem CID 104956948) has the molecular formula C15H17BrFNO2 and a molecular weight of 342.21 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 104956948 |
| Molecular Formula | C15H17BrFNO2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C15H17BrFNO2/c16-11-6-7-12(17)10(9-11)5-8-15(20)18-13-3-1-2-4-14(13)19/h5-9,13-14,19H,1-4H2,(H,18,20)/b8-5+/t13-,14-/m0/s1 |
| InChIKey | SECCNRIVTPLZHB-NSDHSQQOSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|