C21H22BrFN2O — CID 26681649
(E)-N-(1-benzylpiperidin-4-yl)-3-(5-bromo-2-fluorophenyl)prop-2-enamide (PubChem CID 26681649) has the molecular formula C21H22BrFN2O and a molecular weight of 417.32 g/mol. Its IUPAC name is (E)-N-(1-benzylpiperidin-4-yl)-3-(5-bromo-2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(1-benzylpiperidin-4-yl)-3-(5-bromo-2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26681649 |
| Molecular Formula | C21H22BrFN2O |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (E)-N-(1-benzylpiperidin-4-yl)-3-(5-bromo-2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22BrFN2O/c22-18-7-8-20(23)17(14-18)6-9-21(26)24-19-10-12-25(13-11-19)15-16-4-2-1-3-5-16/h1-9,14,19H,10-13,15H2,(H,24,26)/b9-6+ |
| InChIKey | FTVWYVNSMYWMBE-RMKNXTFCSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|