C15H18BrFN2O3S — CID 46462391
(E)-3-(5-bromo-2-fluorophenyl)-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide (PubChem CID 46462391) has the molecular formula C15H18BrFN2O3S and a molecular weight of 405.29 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46462391 |
| Molecular Formula | C15H18BrFN2O3S |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(1-methylsulfonylpiperidin-4-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)/C=C/c2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C15H18BrFN2O3S/c1-23(21,22)19-8-6-13(7-9-19)18-15(20)5-2-11-10-12(16)3-4-14(11)17/h2-5,10,13H,6-9H2,1H3,(H,18,20)/b5-2+ |
| InChIKey | CULKEMMLOGDOQL-GORDUTHDSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|