C19H24BrFN2O2 — CID 47080899
(E)-3-(5-bromo-2-fluorophenyl)-N-[1-(3-methylbutanoyl)piperidin-4-yl]prop-2-enamide (PubChem CID 47080899) has the molecular formula C19H24BrFN2O2 and a molecular weight of 411.32 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[1-(3-methylbutanoyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[1-(3-methylbutanoyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 47080899 |
| Molecular Formula | C19H24BrFN2O2 |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[1-(3-methylbutanoyl)piperidin-4-yl]prop-2-enamide |
| SMILES | CC(C)CC(=O)N1CCC(NC(=O)/C=C/c2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C19H24BrFN2O2/c1-13(2)11-19(25)23-9-7-16(8-10-23)22-18(24)6-3-14-12-15(20)4-5-17(14)21/h3-6,12-13,16H,7-11H2,1-2H3,(H,22,24)/b6-3+ |
| InChIKey | PEVQOQMEJVGLLU-ZZXKWVIFSA-N |
| XLogP | 3.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|